C24H14F6O2Si — CID 91738635
diphenyl-bis(2,3,4-trifluorophenoxy)silane (PubChem CID 91738635) has the molecular formula C24H14F6O2Si and a molecular weight of 476.45 g/mol. Its IUPAC name is diphenyl-bis(2,3,4-trifluorophenoxy)silane.
| Compound Name | diphenyl-bis(2,3,4-trifluorophenoxy)silane |
|---|---|
| PubChem CID | 91738635 |
| Molecular Formula | C24H14F6O2Si |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | diphenyl-bis(2,3,4-trifluorophenoxy)silane |
| SMILES | Fc1ccc(O[Si](Oc2ccc(F)c(F)c2F)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C24H14F6O2Si/c25-17-11-13-19(23(29)21(17)27)31-33(15-7-3-1-4-8-15,16-9-5-2-6-10-16)32-20-14-12-18(26)22(28)24(20)30/h1-14H |
| InChIKey | KCLMAWMBENRQJL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|