C22H21F3O2Si — CID 91732732
2-methylpropoxy-diphenyl-(2,3,4-trifluorophenoxy)silane (PubChem CID 91732732) has the molecular formula C22H21F3O2Si and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-methylpropoxy-diphenyl-(2,3,4-trifluorophenoxy)silane.
| Compound Name | 2-methylpropoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
|---|---|
| PubChem CID | 91732732 |
| Molecular Formula | C22H21F3O2Si |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-methylpropoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
| SMILES | CC(C)CO[Si](Oc1ccc(F)c(F)c1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21F3O2Si/c1-16(2)15-26-28(17-9-5-3-6-10-17,18-11-7-4-8-12-18)27-20-14-13-19(23)21(24)22(20)25/h3-14,16H,15H2,1-2H3 |
| InChIKey | RNPKCFXTBSFAGU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|