C13H15F3O4Si — CID 91741822
trimethylsilyl 3-methyl-4-(2,2,2-trifluoroacetyl)oxybenzoate (PubChem CID 91741822) has the molecular formula C13H15F3O4Si and a molecular weight of 320.34 g/mol. Its IUPAC name is trimethylsilyl 3-methyl-4-(2,2,2-trifluoroacetyl)oxybenzoate.
| Compound Name | trimethylsilyl 3-methyl-4-(2,2,2-trifluoroacetyl)oxybenzoate |
|---|---|
| PubChem CID | 91741822 |
| Molecular Formula | C13H15F3O4Si |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | trimethylsilyl 3-methyl-4-(2,2,2-trifluoroacetyl)oxybenzoate |
| SMILES | Cc1cc(C(=O)O[Si](C)(C)C)ccc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O4Si/c1-8-7-9(11(17)20-21(2,3)4)5-6-10(8)19-12(18)13(14,15)16/h5-7H,1-4H3 |
| InChIKey | HOEIELXXCIOBIZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|