C17H37NO3SSi2 — CID 91743024
[tert-butyl(dimethyl)silyl] 2-[2-[tert-butyl(dimethyl)silyl]sulfanylpropanoylamino]acetate (PubChem CID 91743024) has the molecular formula C17H37NO3SSi2 and a molecular weight of 391.73 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-[2-[tert-butyl(dimethyl)silyl]sulfanylpropanoylamino]acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-[2-[tert-butyl(dimethyl)silyl]sulfanylpropanoylamino]acetate |
|---|---|
| PubChem CID | 91743024 |
| Molecular Formula | C17H37NO3SSi2 |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-[2-[tert-butyl(dimethyl)silyl]sulfanylpropanoylamino]acetate |
| SMILES | CC(S[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H37NO3SSi2/c1-13(22-24(10,11)17(5,6)7)15(20)18-12-14(19)21-23(8,9)16(2,3)4/h13H,12H2,1-11H3,(H,18,20) |
| InChIKey | CRLXDXPOPUOBLG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|