C23H44O2Si — CID 91743551
2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-nonoxysilane (PubChem CID 91743551) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is 2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-nonoxysilane.
| Compound Name | 2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-nonoxysilane |
|---|---|
| PubChem CID | 91743551 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 2,7-dimethyloct-7-en-5-yn-4-yloxy-diethyl-nonoxysilane |
| SMILES | C=C(C)C#CC(CC(C)C)O[Si](CC)(CC)OCCCCCCCCC |
| InChI | InChI=1S/C23H44O2Si/c1-8-11-12-13-14-15-16-19-24-26(9-2,10-3)25-23(20-22(6)7)18-17-21(4)5/h22-23H,4,8-16,19-20H2,1-3,5-7H3 |
| InChIKey | PMUBOBKQPNIPGH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|