C15H23F5N2O4S2 — CID 91744298
ethyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate (PubChem CID 91744298) has the molecular formula C15H23F5N2O4S2 and a molecular weight of 454.48 g/mol. Its IUPAC name is ethyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate.
| Compound Name | ethyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 91744298 |
| Molecular Formula | C15H23F5N2O4S2 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | ethyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
| SMILES | CCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H23F5N2O4S2/c1-4-26-12(24)10(6-8-28-3)21-11(23)9(5-7-27-2)22-13(25)14(16,17)15(18,19)20/h9-10H,4-8H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | IYQSROYSNUICSQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|