C16H25F5N2O4S2 — CID 91744603
propyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate (PubChem CID 91744603) has the molecular formula C16H25F5N2O4S2 and a molecular weight of 468.51 g/mol. Its IUPAC name is propyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate.
| Compound Name | propyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 91744603 |
| Molecular Formula | C16H25F5N2O4S2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | propyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
| SMILES | CCCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H25F5N2O4S2/c1-4-7-27-13(25)11(6-9-29-3)22-12(24)10(5-8-28-2)23-14(26)15(17,18)16(19,20)21/h10-11H,4-9H2,1-3H3,(H,22,24)(H,23,26) |
| InChIKey | MJFBEFMYDBJZKV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|