C17H27F5N2O4S2 — CID 91744883
butyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate (PubChem CID 91744883) has the molecular formula C17H27F5N2O4S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is butyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate.
| Compound Name | butyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 91744883 |
| Molecular Formula | C17H27F5N2O4S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | butyl 4-methylsulfanyl-2-[[4-methylsulfanyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]amino]butanoate |
| SMILES | CCCCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H27F5N2O4S2/c1-4-5-8-28-14(26)12(7-10-30-3)23-13(25)11(6-9-29-2)24-15(27)16(18,19)17(20,21)22/h11-12H,4-10H2,1-3H3,(H,23,25)(H,24,27) |
| InChIKey | SHGKBWPJYDKWPW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|