C17H25F7N2O4S2 — CID 91745414
propyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91745414) has the molecular formula C17H25F7N2O4S2 and a molecular weight of 518.52 g/mol. Its IUPAC name is propyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | propyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91745414 |
| Molecular Formula | C17H25F7N2O4S2 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | propyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H25F7N2O4S2/c1-4-7-30-13(28)11(6-9-32-3)25-12(27)10(5-8-31-2)26-14(29)15(18,19)16(20,21)17(22,23)24/h10-11H,4-9H2,1-3H3,(H,25,27)(H,26,29) |
| InChIKey | RWCHPBZRUMKKPI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|