C17H40O6Si4 — CID 91746738
bis(trimethylsilyl) (2S,4S)-2,4-bis(trimethylsilyloxy)pentanedioate (PubChem CID 91746738) has the molecular formula C17H40O6Si4 and a molecular weight of 452.85 g/mol. Its IUPAC name is bis(trimethylsilyl) (2S,4S)-2,4-bis(trimethylsilyloxy)pentanedioate.
| Compound Name | bis(trimethylsilyl) (2S,4S)-2,4-bis(trimethylsilyloxy)pentanedioate |
|---|---|
| PubChem CID | 91746738 |
| Molecular Formula | C17H40O6Si4 |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | bis(trimethylsilyl) (2S,4S)-2,4-bis(trimethylsilyloxy)pentanedioate |
| SMILES | C[Si](C)(C)OC(=O)[C@H](C[C@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H40O6Si4/c1-24(2,3)20-14(16(18)22-26(7,8)9)13-15(21-25(4,5)6)17(19)23-27(10,11)12/h14-15H,13H2,1-12H3/t14-,15-/m0/s1 |
| InChIKey | KJJOKCNZSWRSBI-GJZGRUSLSA-N |
| XLogP | 4.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|