C15H22O — CID 91749749
(1R,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodeca-2,6-diene (PubChem CID 91749749) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1R,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodeca-2,6-diene.
| Compound Name | (1R,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodeca-2,6-diene |
|---|---|
| PubChem CID | 91749749 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1R,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodeca-2,6-diene |
| SMILES | CC1=CC[C@@H]2C[C@]3(OC2(C)C)C(C)=CCC13 |
| InChI | InChI=1S/C15H22O/c1-10-5-7-12-9-15(16-14(12,3)4)11(2)6-8-13(10)15/h5-6,12-13H,7-9H2,1-4H3/t12-,13?,15+/m1/s1 |
| InChIKey | KVJMJCYPKZHEPD-JHIQODARSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|