C17H28O2 — CID 91750915
[(1S,4R,7S,8S)-2,2,4,8-tetramethyl-8-tricyclo[5.3.1.04,11]undecanyl] acetate (PubChem CID 91750915) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is [(1S,4R,7S,8S)-2,2,4,8-tetramethyl-8-tricyclo[5.3.1.04,11]undecanyl] acetate.
| Compound Name | [(1S,4R,7S,8S)-2,2,4,8-tetramethyl-8-tricyclo[5.3.1.04,11]undecanyl] acetate |
|---|---|
| PubChem CID | 91750915 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | [(1S,4R,7S,8S)-2,2,4,8-tetramethyl-8-tricyclo[5.3.1.04,11]undecanyl] acetate |
| SMILES | CC(=O)O[C@@]1(C)CCC2C3[C@@H]1CC[C@]3(C)CC2(C)C |
| InChI | InChI=1S/C17H28O2/c1-11(18)19-17(5)9-7-12-14-13(17)6-8-16(14,4)10-15(12,2)3/h12-14H,6-10H2,1-5H3/t12?,13-,14?,16+,17-/m0/s1 |
| InChIKey | NXRNOTFYJCHDJC-CGTMSCDWSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |