C15H24BNO6S — CID 91759370
[4-methoxy-3-[(4-methoxycyclohexyl)methylsulfamoyl]phenyl]boronic acid (PubChem CID 91759370) has the molecular formula C15H24BNO6S and a molecular weight of 357.24 g/mol. Its IUPAC name is [4-methoxy-3-[(4-methoxycyclohexyl)methylsulfamoyl]phenyl]boronic acid.
| Compound Name | [4-methoxy-3-[(4-methoxycyclohexyl)methylsulfamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 91759370 |
| Molecular Formula | C15H24BNO6S |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [4-methoxy-3-[(4-methoxycyclohexyl)methylsulfamoyl]phenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)cc1S(=O)(=O)NCC1CCC(OC)CC1 |
| InChI | InChI=1S/C15H24BNO6S/c1-22-13-6-3-11(4-7-13)10-17-24(20,21)15-9-12(16(18)19)5-8-14(15)23-2/h5,8-9,11,13,17-19H,3-4,6-7,10H2,1-2H3 |
| InChIKey | OIZCBXVOCRVGCF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|