About prop-2-enylperoxy sulfite
prop-2-enylperoxy sulfite (PubChem CID 91802886) has the molecular formula C3H5O5S-
and a molecular weight of 153.13 g/mol. Its IUPAC name is prop-2-enylperoxy sulfite.
Molecular Properties
| Compound Name | prop-2-enylperoxy sulfite |
| PubChem CID | 91802886 |
| Molecular Formula | C3H5O5S- |
| Molecular Weight | 153.13 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | prop-2-enylperoxy sulfite |
| SMILES | C=CCOOOS(=O)[O-] |
| InChI | InChI=1S/C3H6O5S/c1-2-3-6-7-8-9(4)5/h2H,1,3H2,(H,4,5)/p-1 |
| InChIKey | VCGWPKAUURDKBS-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.13 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enylperoxy sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enylperoxy sulfite?
The IUPAC name of prop-2-enylperoxy sulfite (CID 91802886) is prop-2-enylperoxy sulfite.
What is the SMILES notation for prop-2-enylperoxy sulfite?
The canonical SMILES for prop-2-enylperoxy sulfite is C=CCOOOS(=O)[O-].
What is the InChIKey of prop-2-enylperoxy sulfite?
The InChIKey is VCGWPKAUURDKBS-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O5S/c1-2-3-6-7-8-9(4)5/h2H,1,3H2,(H,4,5)/p-1.
What are the key properties of prop-2-enylperoxy sulfite?
prop-2-enylperoxy sulfite has a molecular weight of 153.13 g/mol, XLogP of -0.15, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enylperoxy sulfite is sourced from PubChem (CID 91802886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).