5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid

C3HF4N3O2S — CID 91807538

IUPAC5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid
SMILESO=S(O)C1(C(F)(F)F)N=NC(F)=N1
InChIInChI=1S/C3HF4N3O2S/c4-1-8-3(10-9-1,13(11)12)2(5,6)7/h(H,11,12)
InChIKeyNIHWJCXNDTZXAV-UHFFFAOYSA-N
MW219.12 g/mol
LogP1.22
Rot. Bonds1

About 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid

5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid (PubChem CID 91807538) has the molecular formula C3HF4N3O2S and a molecular weight of 219.12 g/mol. Its IUPAC name is 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid.

Molecular Properties

Compound Name5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid
PubChem CID91807538
Molecular FormulaC3HF4N3O2S
Molecular Weight219.12 g/mol
Exact Mass218.97
IUPAC Name5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid
SMILESO=S(O)C1(C(F)(F)F)N=NC(F)=N1
InChIInChI=1S/C3HF4N3O2S/c4-1-8-3(10-9-1,13(11)12)2(5,6)7/h(H,11,12)
InChIKeyNIHWJCXNDTZXAV-UHFFFAOYSA-N
XLogP1.22
TPSA74.38 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.12
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid?
The IUPAC name of 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid (CID 91807538) is 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid.
What is the SMILES notation for 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid?
The canonical SMILES for 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid is O=S(O)C1(C(F)(F)F)N=NC(F)=N1.
What is the InChIKey of 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid?
The InChIKey is NIHWJCXNDTZXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HF4N3O2S/c4-1-8-3(10-9-1,13(11)12)2(5,6)7/h(H,11,12).
What are the key properties of 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid?
5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid has a molecular weight of 219.12 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid is sourced from PubChem (CID 91807538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).