C3HF4N3O2S — CID 91807538
5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid (PubChem CID 91807538) has the molecular formula C3HF4N3O2S and a molecular weight of 219.12 g/mol. Its IUPAC name is 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid.
| Compound Name | 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid |
|---|---|
| PubChem CID | 91807538 |
| Molecular Formula | C3HF4N3O2S |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.97 |
| IUPAC Name | 5-fluoro-3-(trifluoromethyl)-1,2,4-triazole-3-sulfinic acid |
| SMILES | O=S(O)C1(C(F)(F)F)N=NC(F)=N1 |
| InChI | InChI=1S/C3HF4N3O2S/c4-1-8-3(10-9-1,13(11)12)2(5,6)7/h(H,11,12) |
| InChIKey | NIHWJCXNDTZXAV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|