C18H18N4O — CID 91823076
4,6-dimethyl-N-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide (PubChem CID 91823076) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 4,6-dimethyl-N-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide.
| Compound Name | 4,6-dimethyl-N-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 91823076 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4,6-dimethyl-N-phenyl-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7-tetraene-8-carboxamide |
| SMILES | Cc1nn(C)c2nc3c(c(C(=O)Nc4ccccc4)c12)CCC3 |
| InChI | InChI=1S/C18H18N4O/c1-11-15-16(18(23)19-12-7-4-3-5-8-12)13-9-6-10-14(13)20-17(15)22(2)21-11/h3-5,7-8H,6,9-10H2,1-2H3,(H,19,23) |
| InChIKey | NDHMHLIJXCZXEK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |