C20H26N2O — CID 91826159
(Z)-N-(4-tert-butylcyclohexyl)oxy-1-quinolin-8-ylmethanimine (PubChem CID 91826159) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (Z)-N-(4-tert-butylcyclohexyl)oxy-1-quinolin-8-ylmethanimine.
| Compound Name | (Z)-N-(4-tert-butylcyclohexyl)oxy-1-quinolin-8-ylmethanimine |
|---|---|
| PubChem CID | 91826159 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (Z)-N-(4-tert-butylcyclohexyl)oxy-1-quinolin-8-ylmethanimine |
| SMILES | CC(C)(C)C1CCC(O/N=C\c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C20H26N2O/c1-20(2,3)17-9-11-18(12-10-17)23-22-14-16-7-4-6-15-8-5-13-21-19(15)16/h4-8,13-14,17-18H,9-12H2,1-3H3/b22-14- |
| InChIKey | PDSYWGSROMESRO-HMAPJEAMSA-N |
| XLogP | 5.19 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|