C12H22N4O2S — CID 91833748
1-methylsulfonyl-4-(3-pyrazol-1-ylpropyl)-1,4-diazepane (PubChem CID 91833748) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-methylsulfonyl-4-(3-pyrazol-1-ylpropyl)-1,4-diazepane.
| Compound Name | 1-methylsulfonyl-4-(3-pyrazol-1-ylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 91833748 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-methylsulfonyl-4-(3-pyrazol-1-ylpropyl)-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(CCCn2cccn2)CC1 |
| InChI | InChI=1S/C12H22N4O2S/c1-19(17,18)16-10-4-7-14(11-12-16)6-3-9-15-8-2-5-13-15/h2,5,8H,3-4,6-7,9-12H2,1H3 |
| InChIKey | YMBNBWBUBIANIJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |