C17H20N4 — CID 91834255
N-(1H-indol-5-ylmethyl)-N-[2-(1H-pyrazol-4-yl)ethyl]cyclopropanamine (PubChem CID 91834255) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-N-[2-(1H-pyrazol-4-yl)ethyl]cyclopropanamine.
| Compound Name | N-(1H-indol-5-ylmethyl)-N-[2-(1H-pyrazol-4-yl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 91834255 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-N-[2-(1H-pyrazol-4-yl)ethyl]cyclopropanamine |
| SMILES | c1cc2cc(CN(CCc3cn[nH]c3)C3CC3)ccc2[nH]1 |
| InChI | InChI=1S/C17H20N4/c1-4-17-15(5-7-18-17)9-13(1)12-21(16-2-3-16)8-6-14-10-19-20-11-14/h1,4-5,7,9-11,16,18H,2-3,6,8,12H2,(H,19,20) |
| InChIKey | OZGIXYUNZGRCPD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |