About CID 91872170
CID 91872170 (PubChem CID 91872170) has the molecular formula C8H9O2S
and a molecular weight of 169.22 g/mol.
Molecular Properties
| Compound Name | CID 91872170 |
| PubChem CID | 91872170 |
| Molecular Formula | C8H9O2S |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | — |
| SMILES | CCc1ccc([S](=O)=O)cc1 |
| InChI | InChI=1S/C8H9O2S/c1-2-7-3-5-8(6-4-7)11(9)10/h3-6H,2H2,1H3 |
| InChIKey | GGXHVSCZTYUBSQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 91872170 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91872170?
The IUPAC name of CID 91872170 (CID 91872170) is not available.
What is the SMILES notation for CID 91872170?
The canonical SMILES for CID 91872170 is CCc1ccc([S](=O)=O)cc1.
What is the InChIKey of CID 91872170?
The InChIKey is GGXHVSCZTYUBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9O2S/c1-2-7-3-5-8(6-4-7)11(9)10/h3-6H,2H2,1H3.
What are the key properties of CID 91872170?
CID 91872170 has a molecular weight of 169.22 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91872170 is sourced from PubChem (CID 91872170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).