C10H9Cl2N5 — CID 91872292
6-[(2,3-dichlorophenyl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 91872292) has the molecular formula C10H9Cl2N5 and a molecular weight of 270.12 g/mol. Its IUPAC name is 6-[(2,3-dichlorophenyl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2,3-dichlorophenyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 91872292 |
| Molecular Formula | C10H9Cl2N5 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 6-[(2,3-dichlorophenyl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(Cc2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C10H9Cl2N5/c11-6-3-1-2-5(8(6)12)4-7-15-9(13)17-10(14)16-7/h1-3H,4H2,(H4,13,14,15,16,17) |
| InChIKey | WJAGIGHURQQWHK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |