About ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron
ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron (PubChem CID 91872950) has the molecular formula C31H32FeO7
and a molecular weight of 572.43 g/mol. Its IUPAC name is ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron.
Molecular Properties
| Compound Name | ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron |
| PubChem CID | 91872950 |
| Molecular Formula | C31H32FeO7 |
| Molecular Weight | 572.43 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron |
| SMILES | CC(=O)/C=C(\O)c1ccccc1.CC(=O)/C=C(\O)c1ccccc1.CCOC(=O)/C(=C\O)c1ccccc1.[Fe] |
| InChI | InChI=1S/C11H12O3.2C10H10O2.Fe/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9;2*1-8(11)7-10(12)9-5-3-2-4-6-9;/h3-8,12H,2H2,1H3;2*2-7,12H,1H3;/b10-8-;2*10-7-; |
| InChIKey | QQUHETJEANEXTC-VRVFURBRSA-N |
| XLogP | 6.50 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron?
The IUPAC name of ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron (CID 91872950) is ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron.
What is the SMILES notation for ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron?
The canonical SMILES for ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron is CC(=O)/C=C(\O)c1ccccc1.CC(=O)/C=C(\O)c1ccccc1.CCOC(=O)/C(=C\O)c1ccccc1.[Fe].
What is the InChIKey of ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron?
The InChIKey is QQUHETJEANEXTC-VRVFURBRSA-N. The full InChI is InChI=1S/C11H12O3.2C10H10O2.Fe/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9;2*1-8(11)7-10(12)9-5-3-2-4-6-9;/h3-8,12H,2H2,1H3;2*2-7,12H,1H3;/b10-8-;2*10-7-;.
What are the key properties of ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron?
ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron has a molecular weight of 572.43 g/mol, XLogP of 6.50, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3-hydroxy-2-phenylprop-2-enoate;bis((Z)-4-hydroxy-4-phenylbut-3-en-2-one);iron is sourced from PubChem (CID 91872950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).