C16H19N3O6S — CID 9188775
(E)-3-(2,5-dimethoxyphenyl)-N-[2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)ethyl]prop-2-enamide (PubChem CID 9188775) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9188775 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[2-(5-methylsulfonyl-1,3,4-oxadiazol-2-yl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)NCCc2nnc(S(C)(=O)=O)o2)c1 |
| InChI | InChI=1S/C16H19N3O6S/c1-23-12-5-6-13(24-2)11(10-12)4-7-14(20)17-9-8-15-18-19-16(25-15)26(3,21)22/h4-7,10H,8-9H2,1-3H3,(H,17,20)/b7-4+ |
| InChIKey | FRZGSMANNDRPSU-QPJJXVBHSA-N |
| XLogP | 0.86 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|