C22H24F3N2+ — CID 91895872
[(1S,6R)-3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium (PubChem CID 91895872) has the molecular formula C22H24F3N2+ and a molecular weight of 373.44 g/mol. Its IUPAC name is [(1S,6R)-3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium.
| Compound Name | [(1S,6R)-3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium |
|---|---|
| PubChem CID | 91895872 |
| Molecular Formula | C22H24F3N2+ |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | [(1S,6R)-3-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-yl]azanium |
| SMILES | [NH3+][C@H]1CC(CN2CCc3ccccc3C2)=CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H23F3N2/c23-19-11-21(25)20(24)10-18(19)17-6-5-14(9-22(17)26)12-27-8-7-15-3-1-2-4-16(15)13-27/h1-5,10-11,17,22H,6-9,12-13,26H2/p+1/t17-,22+/m1/s1 |
| InChIKey | PPEROMZIWASUGT-VGSWGCGISA-O |
| XLogP | 3.58 |
| TPSA | 30.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|