C19H21N4O5S- — CID 91895888
N-[(3S)-2-(benzylcarbamoyl)-3-(methylcarbamoyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfamate (PubChem CID 91895888) has the molecular formula C19H21N4O5S- and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[(3S)-2-(benzylcarbamoyl)-3-(methylcarbamoyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfamate.
| Compound Name | N-[(3S)-2-(benzylcarbamoyl)-3-(methylcarbamoyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfamate |
|---|---|
| PubChem CID | 91895888 |
| Molecular Formula | C19H21N4O5S- |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[(3S)-2-(benzylcarbamoyl)-3-(methylcarbamoyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfamate |
| SMILES | CNC(=O)[C@@H]1Cc2ccc(NS(=O)(=O)[O-])cc2CN1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H22N4O5S/c1-20-18(24)17-10-14-7-8-16(22-29(26,27)28)9-15(14)12-23(17)19(25)21-11-13-5-3-2-4-6-13/h2-9,17,22H,10-12H2,1H3,(H,20,24)(H,21,25)(H,26,27,28)/p-1/t17-/m0/s1 |
| InChIKey | RIGWVNPBGJUVDI-KRWDZBQOSA-M |
| XLogP | 0.94 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|