C10H8FNO2S — CID 91896050
3-[(2-fluorophenyl)methyl]-4-hydroxy-1,3-thiazol-2-one (PubChem CID 91896050) has the molecular formula C10H8FNO2S and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-4-hydroxy-1,3-thiazol-2-one.
| Compound Name | 3-[(2-fluorophenyl)methyl]-4-hydroxy-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91896050 |
| Molecular Formula | C10H8FNO2S |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.03 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-4-hydroxy-1,3-thiazol-2-one |
| SMILES | O=c1scc(O)n1Cc1ccccc1F |
| InChI | InChI=1S/C10H8FNO2S/c11-8-4-2-1-3-7(8)5-12-9(13)6-15-10(12)14/h1-4,6,13H,5H2 |
| InChIKey | ADDCCVVPCWCZCJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |