C15H15NOS — CID 91896845
3-(3,4-dimethylphenyl)imino-1-thiophen-2-ylpropan-1-one (PubChem CID 91896845) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)imino-1-thiophen-2-ylpropan-1-one.
| Compound Name | 3-(3,4-dimethylphenyl)imino-1-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 91896845 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-(3,4-dimethylphenyl)imino-1-thiophen-2-ylpropan-1-one |
| SMILES | Cc1ccc(/N=C/CC(=O)c2cccs2)cc1C |
| InChI | InChI=1S/C15H15NOS/c1-11-5-6-13(10-12(11)2)16-8-7-14(17)15-4-3-9-18-15/h3-6,8-10H,7H2,1-2H3/b16-8+ |
| InChIKey | PRKYZLCHKBDJKO-LZYBPNLTSA-N |
| XLogP | 4.34 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|