C13H9F2NOS — CID 91896811
3-(3,4-difluorophenyl)imino-1-thiophen-2-ylpropan-1-one (PubChem CID 91896811) has the molecular formula C13H9F2NOS and a molecular weight of 265.28 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)imino-1-thiophen-2-ylpropan-1-one.
| Compound Name | 3-(3,4-difluorophenyl)imino-1-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 91896811 |
| Molecular Formula | C13H9F2NOS |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 3-(3,4-difluorophenyl)imino-1-thiophen-2-ylpropan-1-one |
| SMILES | O=C(C/C=N/c1ccc(F)c(F)c1)c1cccs1 |
| InChI | InChI=1S/C13H9F2NOS/c14-10-4-3-9(8-11(10)15)16-6-5-12(17)13-2-1-7-18-13/h1-4,6-8H,5H2/b16-6+ |
| InChIKey | RJZXUYGPSPYBIO-OMCISZLKSA-N |
| XLogP | 4.00 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|