C14H11NO3S — CID 91896852
3-(1,3-benzodioxol-5-ylimino)-1-thiophen-2-ylpropan-1-one (PubChem CID 91896852) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylimino)-1-thiophen-2-ylpropan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylimino)-1-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 91896852 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylimino)-1-thiophen-2-ylpropan-1-one |
| SMILES | O=C(C/C=N/c1ccc2c(c1)OCO2)c1cccs1 |
| InChI | InChI=1S/C14H11NO3S/c16-11(14-2-1-7-19-14)5-6-15-10-3-4-12-13(8-10)18-9-17-12/h1-4,6-8H,5,9H2/b15-6+ |
| InChIKey | HRTHWMNQOWWNHY-GIDUJCDVSA-N |
| XLogP | 3.45 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|