C15H24N2O4 — CID 91909508
2-(2-methoxyethoxy)-N-[(2-oxo-1,3,4,5,6,7-hexahydroquinolin-4a-yl)methyl]acetamide (PubChem CID 91909508) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-[(2-oxo-1,3,4,5,6,7-hexahydroquinolin-4a-yl)methyl]acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-[(2-oxo-1,3,4,5,6,7-hexahydroquinolin-4a-yl)methyl]acetamide |
|---|---|
| PubChem CID | 91909508 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-[(2-oxo-1,3,4,5,6,7-hexahydroquinolin-4a-yl)methyl]acetamide |
| SMILES | COCCOCC(=O)NCC12CCCC=C1NC(=O)CC2 |
| InChI | InChI=1S/C15H24N2O4/c1-20-8-9-21-10-14(19)16-11-15-6-3-2-4-12(15)17-13(18)5-7-15/h4H,2-3,5-11H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | MSLPHYVQTIZLOZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|