C14H19N5O2 — CID 91929390
2,2-dicyano-N-[2-[[5-(methoxymethyl)furan-2-yl]methylamino]ethyl]-N'-methylethanimidamide (PubChem CID 91929390) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2,2-dicyano-N-[2-[[5-(methoxymethyl)furan-2-yl]methylamino]ethyl]-N'-methylethanimidamide.
| Compound Name | 2,2-dicyano-N-[2-[[5-(methoxymethyl)furan-2-yl]methylamino]ethyl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 91929390 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2,2-dicyano-N-[2-[[5-(methoxymethyl)furan-2-yl]methylamino]ethyl]-N'-methylethanimidamide |
| SMILES | C/N=C(/NCCNCc1ccc(COC)o1)C(C#N)C#N |
| InChI | InChI=1S/C14H19N5O2/c1-17-14(11(7-15)8-16)19-6-5-18-9-12-3-4-13(21-12)10-20-2/h3-4,11,18H,5-6,9-10H2,1-2H3,(H,17,19) |
| InChIKey | BJRCXGGODMLTGV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|