C17H16F3N4+ — CID 91935953
[(3R,4R)-1-(5-cyano-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium (PubChem CID 91935953) has the molecular formula C17H16F3N4+ and a molecular weight of 333.34 g/mol. Its IUPAC name is [(3R,4R)-1-(5-cyano-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium.
| Compound Name | [(3R,4R)-1-(5-cyano-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 91935953 |
| Molecular Formula | C17H16F3N4+ |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [(3R,4R)-1-(5-cyano-2-pyridinyl)-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
| SMILES | N#Cc1ccc(N2CC[C@H](c3cc(F)c(F)cc3F)[C@@H]([NH3+])C2)nc1 |
| InChI | InChI=1S/C17H15F3N4/c18-13-6-15(20)14(19)5-12(13)11-3-4-24(9-16(11)22)17-2-1-10(7-21)8-23-17/h1-2,5-6,8,11,16H,3-4,9,22H2/p+1/t11-,16+/m1/s1 |
| InChIKey | PMLGYTQZSGDFPU-BZNIZROVSA-O |
| XLogP | 1.97 |
| TPSA | 67.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|