C26H25ClN2O6S — CID 91937919
4-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-1,3-dimethoxy-6-methylxanthen-9-one (PubChem CID 91937919) has the molecular formula C26H25ClN2O6S and a molecular weight of 529.01 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-1,3-dimethoxy-6-methylxanthen-9-one.
| Compound Name | 4-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-1,3-dimethoxy-6-methylxanthen-9-one |
|---|---|
| PubChem CID | 91937919 |
| Molecular Formula | C26H25ClN2O6S |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | 4-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-1,3-dimethoxy-6-methylxanthen-9-one |
| SMILES | COc1cc(OC)c2c(=O)c3ccc(C)cc3oc2c1S(=O)(=O)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C26H25ClN2O6S/c1-16-8-9-17-20(14-16)35-25-23(24(17)30)21(33-2)15-22(34-3)26(25)36(31,32)29-12-10-28(11-13-29)19-7-5-4-6-18(19)27/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | UTUBXMVMIPAGNN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|