C26H27N3O8S — CID 46830280
1,3,6,7-tetramethoxy-4-(4-pyridin-2-ylpiperazin-1-yl)sulfonylxanthen-9-one (PubChem CID 46830280) has the molecular formula C26H27N3O8S and a molecular weight of 541.58 g/mol. Its IUPAC name is 1,3,6,7-tetramethoxy-4-(4-pyridin-2-ylpiperazin-1-yl)sulfonylxanthen-9-one.
| Compound Name | 1,3,6,7-tetramethoxy-4-(4-pyridin-2-ylpiperazin-1-yl)sulfonylxanthen-9-one |
|---|---|
| PubChem CID | 46830280 |
| Molecular Formula | C26H27N3O8S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1,3,6,7-tetramethoxy-4-(4-pyridin-2-ylpiperazin-1-yl)sulfonylxanthen-9-one |
| SMILES | COc1cc2oc3c(S(=O)(=O)N4CCN(c5ccccn5)CC4)c(OC)cc(OC)c3c(=O)c2cc1OC |
| InChI | InChI=1S/C26H27N3O8S/c1-33-18-13-16-17(14-19(18)34-2)37-25-23(24(16)30)20(35-3)15-21(36-4)26(25)38(31,32)29-11-9-28(10-12-29)22-7-5-6-8-27-22/h5-8,13-15H,9-12H2,1-4H3 |
| InChIKey | STMNDOWKMZYOFX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|