C30H27NO8S — CID 46886968
N-benzhydryl-1,3,6,7-tetramethoxy-9-oxoxanthene-4-sulfonamide (PubChem CID 46886968) has the molecular formula C30H27NO8S and a molecular weight of 561.61 g/mol. Its IUPAC name is N-benzhydryl-1,3,6,7-tetramethoxy-9-oxoxanthene-4-sulfonamide.
| Compound Name | N-benzhydryl-1,3,6,7-tetramethoxy-9-oxoxanthene-4-sulfonamide |
|---|---|
| PubChem CID | 46886968 |
| Molecular Formula | C30H27NO8S |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | N-benzhydryl-1,3,6,7-tetramethoxy-9-oxoxanthene-4-sulfonamide |
| SMILES | COc1cc2oc3c(S(=O)(=O)NC(c4ccccc4)c4ccccc4)c(OC)cc(OC)c3c(=O)c2cc1OC |
| InChI | InChI=1S/C30H27NO8S/c1-35-22-15-20-21(16-23(22)36-2)39-29-26(28(20)32)24(37-3)17-25(38-4)30(29)40(33,34)31-27(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-17,27,31H,1-4H3 |
| InChIKey | XLYOYLBNTSIYNO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|