C20H14ClFN4O2 — CID 91942882
N-(5-chloro-2-pyridinyl)-2-[3-(5-fluoro-3-pyridinyl)prop-2-enoylamino]benzamide (PubChem CID 91942882) has the molecular formula C20H14ClFN4O2 and a molecular weight of 396.81 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[3-(5-fluoro-3-pyridinyl)prop-2-enoylamino]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[3-(5-fluoro-3-pyridinyl)prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 91942882 |
| Molecular Formula | C20H14ClFN4O2 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[3-(5-fluoro-3-pyridinyl)prop-2-enoylamino]benzamide |
| SMILES | O=C(C=Cc1cncc(F)c1)Nc1ccccc1C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H14ClFN4O2/c21-14-6-7-18(24-11-14)26-20(28)16-3-1-2-4-17(16)25-19(27)8-5-13-9-15(22)12-23-10-13/h1-12H,(H,25,27)(H,24,26,28) |
| InChIKey | NVSOKCIFKMIJDM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|