C12H12ClN3O — CID 91944584
[(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]urea (PubChem CID 91944584) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is [(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]urea.
| Compound Name | [(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 91944584 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | [(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]urea |
| SMILES | NC(=O)NN=CC1=C(Cl)c2ccccc2CC1 |
| InChI | InChI=1S/C12H12ClN3O/c13-11-9(7-15-16-12(14)17)6-5-8-3-1-2-4-10(8)11/h1-4,7H,5-6H2,(H3,14,16,17) |
| InChIKey | JXVDMGZJGOJEFN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|