C18H14Cl2N2O2 — CID 7338820
5-chloro-N-[(Z)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-2-hydroxybenzamide (PubChem CID 7338820) has the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.23 g/mol. Its IUPAC name is 5-chloro-N-[(Z)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-[(Z)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 7338820 |
| Molecular Formula | C18H14Cl2N2O2 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 5-chloro-N-[(Z)-(1-chloro-3,4-dihydronaphthalen-2-yl)methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(N/N=C\C1=C(Cl)c2ccccc2CC1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C18H14Cl2N2O2/c19-13-7-8-16(23)15(9-13)18(24)22-21-10-12-6-5-11-3-1-2-4-14(11)17(12)20/h1-4,7-10,23H,5-6H2,(H,22,24)/b21-10- |
| InChIKey | ZUYKFFQTYXFLSB-FBHDLOMBSA-N |
| XLogP | 4.36 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|