C20H24N2O6S — CID 91950561
ethyl 1-[5-(cyclopropylsulfamoyl)-1-benzofuran-2-carbonyl]piperidine-3-carboxylate (PubChem CID 91950561) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is ethyl 1-[5-(cyclopropylsulfamoyl)-1-benzofuran-2-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-(cyclopropylsulfamoyl)-1-benzofuran-2-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 91950561 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | ethyl 1-[5-(cyclopropylsulfamoyl)-1-benzofuran-2-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cc3cc(S(=O)(=O)NC4CC4)ccc3o2)C1 |
| InChI | InChI=1S/C20H24N2O6S/c1-2-27-20(24)13-4-3-9-22(12-13)19(23)18-11-14-10-16(7-8-17(14)28-18)29(25,26)21-15-5-6-15/h7-8,10-11,13,15,21H,2-6,9,12H2,1H3 |
| InChIKey | VUINKGIPTUMIIM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |