C19H24FN3O3 — CID 91953107
5-[3-(2-ethylimidazol-1-yl)propylamino]-3-(4-fluorophenyl)-5-oxopentanoic acid (PubChem CID 91953107) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 5-[3-(2-ethylimidazol-1-yl)propylamino]-3-(4-fluorophenyl)-5-oxopentanoic acid.
| Compound Name | 5-[3-(2-ethylimidazol-1-yl)propylamino]-3-(4-fluorophenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91953107 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 5-[3-(2-ethylimidazol-1-yl)propylamino]-3-(4-fluorophenyl)-5-oxopentanoic acid |
| SMILES | CCc1nccn1CCCNC(=O)CC(CC(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FN3O3/c1-2-17-21-9-11-23(17)10-3-8-22-18(24)12-15(13-19(25)26)14-4-6-16(20)7-5-14/h4-7,9,11,15H,2-3,8,10,12-13H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | LZBFQWPJURMYDH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|