C22H27N3O4S — CID 91954211
N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]-1,2,3-trimethylindole-5-carboxamide (PubChem CID 91954211) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]-1,2,3-trimethylindole-5-carboxamide.
| Compound Name | N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]-1,2,3-trimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 91954211 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]-1,2,3-trimethylindole-5-carboxamide |
| SMILES | COCCNS(=O)(=O)Cc1cccc(NC(=O)c2ccc3c(c2)c(C)c(C)n3C)c1 |
| InChI | InChI=1S/C22H27N3O4S/c1-15-16(2)25(3)21-9-8-18(13-20(15)21)22(26)24-19-7-5-6-17(12-19)14-30(27,28)23-10-11-29-4/h5-9,12-13,23H,10-11,14H2,1-4H3,(H,24,26) |
| InChIKey | XBLPXWQGTVJWCK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|