C29H34N6O — CID 91970512
3-phenyl-2-[4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenyl]-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one (PubChem CID 91970512) has the molecular formula C29H34N6O and a molecular weight of 482.63 g/mol. Its IUPAC name is 3-phenyl-2-[4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenyl]-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one.
| Compound Name | 3-phenyl-2-[4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenyl]-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 91970512 |
| Molecular Formula | C29H34N6O |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 3-phenyl-2-[4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]phenyl]-2,3,4,4a,6,7,8,8a-octahydro-1H-1,6-naphthyridin-5-one |
| SMILES | O=C1NCCC2NC(c3ccc(CN4CCN(c5ncccn5)CC4)cc3)C(c3ccccc3)CC12 |
| InChI | InChI=1S/C29H34N6O/c36-28-25-19-24(22-5-2-1-3-6-22)27(33-26(25)11-14-30-28)23-9-7-21(8-10-23)20-34-15-17-35(18-16-34)29-31-12-4-13-32-29/h1-10,12-13,24-27,33H,11,14-20H2,(H,30,36) |
| InChIKey | CLQFYZULAVETFO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |