C26H35N7O — CID 91971963
4-[[2-(butylamino)-5-[5-[(pyridin-4-ylmethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 91971963) has the molecular formula C26H35N7O and a molecular weight of 461.61 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-[5-[(pyridin-4-ylmethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-[5-[(pyridin-4-ylmethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 91971963 |
| Molecular Formula | C26H35N7O |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 4-[[2-(butylamino)-5-[5-[(pyridin-4-ylmethylamino)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(CNCc3ccncc3)cn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C26H35N7O/c1-2-3-12-29-26-31-18-23(25(33-26)32-21-5-7-22(34)8-6-21)24-9-4-20(17-30-24)16-28-15-19-10-13-27-14-11-19/h4,9-11,13-14,17-18,21-22,28,34H,2-3,5-8,12,15-16H2,1H3,(H2,29,31,32,33) |
| InChIKey | IADRGGYOCXDICI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|