About triphenylstannane;hydrofluoride
triphenylstannane;hydrofluoride (PubChem CID 91997541) has the molecular formula C18H17FSn
and a molecular weight of 371.04 g/mol. Its IUPAC name is triphenylstannane;hydrofluoride.
Molecular Properties
| Compound Name | triphenylstannane;hydrofluoride |
| PubChem CID | 91997541 |
| Molecular Formula | C18H17FSn |
| Molecular Weight | 371.04 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | triphenylstannane;hydrofluoride |
| SMILES | F.c1ccc([SnH](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.FH.Sn.H/c3*1-2-4-6-5-3-1;;;/h3*1-5H;1H;; |
| InChIKey | SZNZEEYJVCQHCQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.04 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze triphenylstannane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylstannane;hydrofluoride?
The IUPAC name of triphenylstannane;hydrofluoride (CID 91997541) is triphenylstannane;hydrofluoride.
What is the SMILES notation for triphenylstannane;hydrofluoride?
The canonical SMILES for triphenylstannane;hydrofluoride is F.c1ccc([SnH](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of triphenylstannane;hydrofluoride?
The InChIKey is SZNZEEYJVCQHCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H5.FH.Sn.H/c3*1-2-4-6-5-3-1;;;/h3*1-5H;1H;;.
What are the key properties of triphenylstannane;hydrofluoride?
triphenylstannane;hydrofluoride has a molecular weight of 371.04 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylstannane;hydrofluoride is sourced from PubChem (CID 91997541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).