About hydron;triphenylstannane
hydron;triphenylstannane (PubChem CID 174928109) has the molecular formula C18H17Sn+
and a molecular weight of 352.05 g/mol. Its IUPAC name is hydron;triphenylstannane.
Molecular Properties
| Compound Name | hydron;triphenylstannane |
| PubChem CID | 174928109 |
| Molecular Formula | C18H17Sn+ |
| Molecular Weight | 352.05 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | hydron;triphenylstannane |
| SMILES | [H+].c1ccc([SnH](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/3C6H5.Sn.H/c3*1-2-4-6-5-3-1;;/h3*1-5H;;/p+1 |
| InChIKey | NFHRNKANAAGQOH-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.05 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hydron;triphenylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;triphenylstannane?
The IUPAC name of hydron;triphenylstannane (CID 174928109) is hydron;triphenylstannane.
What is the SMILES notation for hydron;triphenylstannane?
The canonical SMILES for hydron;triphenylstannane is [H+].c1ccc([SnH](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of hydron;triphenylstannane?
The InChIKey is NFHRNKANAAGQOH-UHFFFAOYSA-O. The full InChI is InChI=1S/3C6H5.Sn.H/c3*1-2-4-6-5-3-1;;/h3*1-5H;;/p+1.
What are the key properties of hydron;triphenylstannane?
hydron;triphenylstannane has a molecular weight of 352.05 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;triphenylstannane is sourced from PubChem (CID 174928109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).