About [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate (PubChem CID 9203178) has the molecular formula C12H12Cl2N2O4
and a molecular weight of 319.14 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate.
Molecular Properties
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate |
| PubChem CID | 9203178 |
| Molecular Formula | C12H12Cl2N2O4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate |
| SMILES | CNC(=O)CNC(=O)COC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O4/c1-15-10(17)5-16-11(18)6-20-12(19)7-2-8(13)4-9(14)3-7/h2-4H,5-6H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | CMTFUGPVKNCFBG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate?
The IUPAC name of [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate (CID 9203178) is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate.
What is the SMILES notation for [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate?
The canonical SMILES for [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate is CNC(=O)CNC(=O)COC(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate?
The InChIKey is CMTFUGPVKNCFBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2O4/c1-15-10(17)5-16-11(18)6-20-12(19)7-2-8(13)4-9(14)3-7/h2-4H,5-6H2,1H3,(H,15,17)(H,16,18).
What are the key properties of [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate?
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate has a molecular weight of 319.14 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 3,5-dichlorobenzoate is sourced from PubChem (CID 9203178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).