C15H23N3O2 — CID 9204914
2-(3,5-dimethylphenoxy)-N-(4-methylpiperazin-1-yl)acetamide (PubChem CID 9204914) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 9204914 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-(4-methylpiperazin-1-yl)acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C15H23N3O2/c1-12-8-13(2)10-14(9-12)20-11-15(19)16-18-6-4-17(3)5-7-18/h8-10H,4-7,11H2,1-3H3,(H,16,19) |
| InChIKey | QGLDSPMZQKVMJP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |