C19H26N4O3S2 — CID 9216814
methyl 6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)carbamothioylamino]hexanoate (PubChem CID 9216814) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is methyl 6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 9216814 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | methyl 6-[(2-morpholin-4-yl-1,3-benzothiazol-6-yl)carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)Nc1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-25-17(24)5-3-2-4-8-20-18(27)21-14-6-7-15-16(13-14)28-19(22-15)23-9-11-26-12-10-23/h6-7,13H,2-5,8-12H2,1H3,(H2,20,21,27) |
| InChIKey | VVAHYNXEWYWYLU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|