C18H26N5O2S2+ — CID 9216683
1-(2-morpholin-4-ium-4-ylethyl)-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)thiourea (PubChem CID 9216683) has the molecular formula C18H26N5O2S2+ and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-(2-morpholin-4-ium-4-ylethyl)-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)thiourea.
| Compound Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)thiourea |
|---|---|
| PubChem CID | 9216683 |
| Molecular Formula | C18H26N5O2S2+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)thiourea |
| SMILES | S=C(NCC[NH+]1CCOCC1)Nc1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C18H25N5O2S2/c26-17(19-3-4-22-5-9-24-10-6-22)20-14-1-2-15-16(13-14)27-18(21-15)23-7-11-25-12-8-23/h1-2,13H,3-12H2,(H2,19,20,26)/p+1 |
| InChIKey | RSZUFXBEYQNSTQ-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 63.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|