C15H22ClN5OS2 — CID 9217930
1-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 9217930) has the molecular formula C15H22ClN5OS2 and a molecular weight of 387.96 g/mol. Its IUPAC name is 1-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9217930 |
| Molecular Formula | C15H22ClN5OS2 |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1CCCO1)N/N=C\c1sc(N2CCCCC2)nc1Cl |
| InChI | InChI=1S/C15H22ClN5OS2/c16-13-12(24-15(19-13)21-6-2-1-3-7-21)10-18-20-14(23)17-9-11-5-4-8-22-11/h10-11H,1-9H2,(H2,17,20,23)/b18-10-/t11-/m0/s1 |
| InChIKey | OKDRWGBENIUMEL-TZQXVGBESA-N |
| XLogP | 2.76 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|